C11H10FNO3S — CID 138546884
1-(4-fluorophenyl)sulfonyl-2,5-dihydropyrrole-3-carbaldehyde (PubChem CID 138546884) has the molecular formula C11H10FNO3S and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-2,5-dihydropyrrole-3-carbaldehyde.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-2,5-dihydropyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 138546884 |
| Molecular Formula | C11H10FNO3S |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-2,5-dihydropyrrole-3-carbaldehyde |
| SMILES | O=CC1=CCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C11H10FNO3S/c12-10-1-3-11(4-2-10)17(15,16)13-6-5-9(7-13)8-14/h1-5,8H,6-7H2 |
| InChIKey | CPNIUUNIRCRBNC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|