C6H17IN4 — CID 138548509
N'-[2-[2-aminoethyl(iodo)amino]ethyl]ethane-1,2-diamine (PubChem CID 138548509) has the molecular formula C6H17IN4 and a molecular weight of 272.13 g/mol. Its IUPAC name is N'-[2-[2-aminoethyl(iodo)amino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[2-aminoethyl(iodo)amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 138548509 |
| Molecular Formula | C6H17IN4 |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | N'-[2-[2-aminoethyl(iodo)amino]ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCN(I)CCN |
| InChI | InChI=1S/C6H17IN4/c7-11(5-2-9)6-4-10-3-1-8/h10H,1-6,8-9H2 |
| InChIKey | BOVFWMGZPLSYBY-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|