About N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine
N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine (PubChem CID 90401102) has the molecular formula C4H10I2N2
and a molecular weight of 339.95 g/mol. Its IUPAC name is N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine |
| PubChem CID | 90401102 |
| Molecular Formula | C4H10I2N2 |
| Molecular Weight | 339.95 g/mol |
| Exact Mass | 339.89 |
| IUPAC Name | N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine |
| SMILES | NCCN(I)CCI |
| InChI | InChI=1S/C4H10I2N2/c5-1-3-8(6)4-2-7/h1-4,7H2 |
| InChIKey | BYCRQTGKEYIVJZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.95 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine?
The IUPAC name of N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine (CID 90401102) is N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine.
What is the SMILES notation for N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine?
The canonical SMILES for N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine is NCCN(I)CCI.
What is the InChIKey of N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine?
The InChIKey is BYCRQTGKEYIVJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10I2N2/c5-1-3-8(6)4-2-7/h1-4,7H2.
What are the key properties of N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine?
N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine has a molecular weight of 339.95 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine is sourced from PubChem (CID 90401102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).