C4H10I2N2 — CID 90401102
N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine (PubChem CID 90401102) has the molecular formula C4H10I2N2 and a molecular weight of 339.95 g/mol. Its IUPAC name is N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine.
| Compound Name | N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 90401102 |
| Molecular Formula | C4H10I2N2 |
| Molecular Weight | 339.95 g/mol |
| Exact Mass | 339.89 |
| IUPAC Name | N'-iodo-N'-(2-iodoethyl)ethane-1,2-diamine |
| SMILES | NCCN(I)CCI |
| InChI | InChI=1S/C4H10I2N2/c5-1-3-8(6)4-2-7/h1-4,7H2 |
| InChIKey | BYCRQTGKEYIVJZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.95 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|