C4H13N3S — CID 167298608
N,N-bis(2-aminoethyl)thiohydroxylamine (PubChem CID 167298608) has the molecular formula C4H13N3S and a molecular weight of 135.24 g/mol. Its IUPAC name is N,N-bis(2-aminoethyl)thiohydroxylamine.
| Compound Name | N,N-bis(2-aminoethyl)thiohydroxylamine |
|---|---|
| PubChem CID | 167298608 |
| Molecular Formula | C4H13N3S |
| Molecular Weight | 135.24 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | N,N-bis(2-aminoethyl)thiohydroxylamine |
| SMILES | NCCN(S)CCN |
| InChI | InChI=1S/C4H13N3S/c5-1-3-7(8)4-2-6/h8H,1-6H2 |
| InChIKey | JNSJESQABYUONI-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.24 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|