C6H17N5O — CID 87376084
N-(2-aminoethyl)-N-[2-(2-aminoethylamino)ethyl]nitrous amide (PubChem CID 87376084) has the molecular formula C6H17N5O and a molecular weight of 175.24 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-[2-(2-aminoethylamino)ethyl]nitrous amide.
| Compound Name | N-(2-aminoethyl)-N-[2-(2-aminoethylamino)ethyl]nitrous amide |
|---|---|
| PubChem CID | 87376084 |
| Molecular Formula | C6H17N5O |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-(2-aminoethyl)-N-[2-(2-aminoethylamino)ethyl]nitrous amide |
| SMILES | NCCNCCN(CCN)N=O |
| InChI | InChI=1S/C6H17N5O/c7-1-3-9-4-6-11(10-12)5-2-8/h9H,1-8H2 |
| InChIKey | AJGXTBJITHWOQH-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|