C29H38N4O9S — CID 138549944
(9S,12S,15S)-12-(2-morpholin-4-ylethyl)-11,14-dioxo-15-(3-sulfopropylamino)-2-oxa-10,13-diazatricyclo[15.3.1.13,7]docosa-1(20),3,5,7(22),17(21),18-hexaene-9-carboxylic acid (PubChem CID 138549944) has the molecular formula C29H38N4O9S and a molecular weight of 618.71 g/mol. Its IUPAC name is (9S,12S,15S)-12-(2-morpholin-4-ylethyl)-11,14-dioxo-15-(3-sulfopropylamino)-2-oxa-10,13-diazatricyclo[15.3.1.13,7]docosa-1(20),3,5,7(22),17(21),18-hexaene-9-carboxylic acid.
| Compound Name | (9S,12S,15S)-12-(2-morpholin-4-ylethyl)-11,14-dioxo-15-(3-sulfopropylamino)-2-oxa-10,13-diazatricyclo[15.3.1.13,7]docosa-1(20),3,5,7(22),17(21),18-hexaene-9-carboxylic acid |
|---|---|
| PubChem CID | 138549944 |
| Molecular Formula | C29H38N4O9S |
| Molecular Weight | 618.71 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | (9S,12S,15S)-12-(2-morpholin-4-ylethyl)-11,14-dioxo-15-(3-sulfopropylamino)-2-oxa-10,13-diazatricyclo[15.3.1.13,7]docosa-1(20),3,5,7(22),17(21),18-hexaene-9-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Cc2cccc(c2)Oc2cccc(c2)C[C@H](NCCCS(=O)(=O)O)C(=O)N[C@@H](CCN2CCOCC2)C(=O)N1 |
| InChI | InChI=1S/C29H38N4O9S/c34-27-24(8-10-33-11-13-41-14-12-33)31-28(35)25(30-9-3-15-43(38,39)40)18-20-4-1-6-22(16-20)42-23-7-2-5-21(17-23)19-26(32-27)29(36)37/h1-2,4-7,16-17,24-26,30H,3,8-15,18-19H2,(H,31,35)(H,32,34)(H,36,37)(H,38,39,40)/t24-,25-,26-/m0/s1 |
| InChIKey | RQRJYOJEGKKBJZ-GSDHBNRESA-N |
| XLogP | 0.59 |
| TPSA | 183.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.71 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|