C16H19NO4 — CID 138550487
2-(2-oxopyrrolidin-1-yl)-3-(3-prop-2-enoxyphenyl)propanoic acid (PubChem CID 138550487) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(2-oxopyrrolidin-1-yl)-3-(3-prop-2-enoxyphenyl)propanoic acid.
| Compound Name | 2-(2-oxopyrrolidin-1-yl)-3-(3-prop-2-enoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 138550487 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-(2-oxopyrrolidin-1-yl)-3-(3-prop-2-enoxyphenyl)propanoic acid |
| SMILES | C=CCOc1cccc(CC(C(=O)O)N2CCCC2=O)c1 |
| InChI | InChI=1S/C16H19NO4/c1-2-9-21-13-6-3-5-12(10-13)11-14(16(19)20)17-8-4-7-15(17)18/h2-3,5-6,10,14H,1,4,7-9,11H2,(H,19,20) |
| InChIKey | YUKIQKGGMKHUQP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|