C20H33FN7O6P — CID 138554945
propan-2-yl (2S)-2-[[(2S,3R)-3-[1-[2-amino-6-(dimethylamino)purin-9-yl]-2-fluoroethoxy]-4-phosphorosooxybutan-2-yl]oxymethylamino]propanoate (PubChem CID 138554945) has the molecular formula C20H33FN7O6P and a molecular weight of 517.50 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2S,3R)-3-[1-[2-amino-6-(dimethylamino)purin-9-yl]-2-fluoroethoxy]-4-phosphorosooxybutan-2-yl]oxymethylamino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2S,3R)-3-[1-[2-amino-6-(dimethylamino)purin-9-yl]-2-fluoroethoxy]-4-phosphorosooxybutan-2-yl]oxymethylamino]propanoate |
|---|---|
| PubChem CID | 138554945 |
| Molecular Formula | C20H33FN7O6P |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2S,3R)-3-[1-[2-amino-6-(dimethylamino)purin-9-yl]-2-fluoroethoxy]-4-phosphorosooxybutan-2-yl]oxymethylamino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NCO[C@@H](C)[C@@H](COP=O)OC(CF)n1cnc2c(N(C)C)nc(N)nc21 |
| InChI | InChI=1S/C20H33FN7O6P/c1-11(2)33-19(29)12(3)24-10-31-13(4)14(8-32-35-30)34-15(7-21)28-9-23-16-17(27(5)6)25-20(22)26-18(16)28/h9,11-15,24H,7-8,10H2,1-6H3,(H2,22,25,26)/t12-,13-,14+,15?/m0/s1 |
| InChIKey | UHSWJSMXJIWVMK-RDGKXADDSA-N |
| XLogP | 1.84 |
| TPSA | 155.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|