C18H23FN6O3 — CID 139293851
(2R,3S)-2-[(1R)-1-[2-amino-6-(dicyclopropylamino)purin-9-yl]-2-fluoroethoxy]pent-4-yne-1,3-diol (PubChem CID 139293851) has the molecular formula C18H23FN6O3 and a molecular weight of 390.42 g/mol. Its IUPAC name is (2R,3S)-2-[(1R)-1-[2-amino-6-(dicyclopropylamino)purin-9-yl]-2-fluoroethoxy]pent-4-yne-1,3-diol.
| Compound Name | (2R,3S)-2-[(1R)-1-[2-amino-6-(dicyclopropylamino)purin-9-yl]-2-fluoroethoxy]pent-4-yne-1,3-diol |
|---|---|
| PubChem CID | 139293851 |
| Molecular Formula | C18H23FN6O3 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (2R,3S)-2-[(1R)-1-[2-amino-6-(dicyclopropylamino)purin-9-yl]-2-fluoroethoxy]pent-4-yne-1,3-diol |
| SMILES | C#C[C@H](O)[C@@H](CO)O[C@H](CF)n1cnc2c(N(C3CC3)C3CC3)nc(N)nc21 |
| InChI | InChI=1S/C18H23FN6O3/c1-2-12(27)13(8-26)28-14(7-19)24-9-21-15-16(24)22-18(20)23-17(15)25(10-3-4-10)11-5-6-11/h1,9-14,26-27H,3-8H2,(H2,20,22,23)/t12-,13+,14+/m0/s1 |
| InChIKey | KHQYVASDCJUDGF-BFHYXJOUSA-N |
| XLogP | 0.38 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|