C16H22N6O2 — CID 154993172
2-[1-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]ethoxy]pent-4-yn-1-ol (PubChem CID 154993172) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[1-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]ethoxy]pent-4-yn-1-ol.
| Compound Name | 2-[1-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]ethoxy]pent-4-yn-1-ol |
|---|---|
| PubChem CID | 154993172 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-[1-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]ethoxy]pent-4-yn-1-ol |
| SMILES | C#CCC(CO)OC(C)n1cnc2c(N(C)C3CC3)nc(N)nc21 |
| InChI | InChI=1S/C16H22N6O2/c1-4-5-12(8-23)24-10(2)22-9-18-13-14(21(3)11-6-7-11)19-16(17)20-15(13)22/h1,9-12,23H,5-8H2,2-3H3,(H2,17,19,20) |
| InChIKey | SSDSZXHPWPOEJK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|