C14H22N3O2P — CID 138567048
2-methyl-2-nitroso-N-(2-phosphanyl-4-pyridinyl)octanamide (PubChem CID 138567048) has the molecular formula C14H22N3O2P and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-methyl-2-nitroso-N-(2-phosphanyl-4-pyridinyl)octanamide.
| Compound Name | 2-methyl-2-nitroso-N-(2-phosphanyl-4-pyridinyl)octanamide |
|---|---|
| PubChem CID | 138567048 |
| Molecular Formula | C14H22N3O2P |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-methyl-2-nitroso-N-(2-phosphanyl-4-pyridinyl)octanamide |
| SMILES | CCCCCCC(C)(N=O)C(=O)Nc1ccnc(P)c1 |
| InChI | InChI=1S/C14H22N3O2P/c1-3-4-5-6-8-14(2,17-19)13(18)16-11-7-9-15-12(20)10-11/h7,9-10H,3-6,8,20H2,1-2H3,(H,15,16,18) |
| InChIKey | XAUHXTQWXWMNCQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|