C12H19N — CID 138569160
(E)-N-ethenyl-2,2,5-trimethylhept-4-en-6-yn-3-amine (PubChem CID 138569160) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (E)-N-ethenyl-2,2,5-trimethylhept-4-en-6-yn-3-amine.
| Compound Name | (E)-N-ethenyl-2,2,5-trimethylhept-4-en-6-yn-3-amine |
|---|---|
| PubChem CID | 138569160 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (E)-N-ethenyl-2,2,5-trimethylhept-4-en-6-yn-3-amine |
| SMILES | C#C/C(C)=C/C(NC=C)C(C)(C)C |
| InChI | InChI=1S/C12H19N/c1-7-10(3)9-11(13-8-2)12(4,5)6/h1,8-9,11,13H,2H2,3-6H3/b10-9+ |
| InChIKey | TYCBYOSXPWCRIP-MDZDMXLPSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|