C15H18O — CID 143326499
(3Z,5Z,7E)-6-buta-1,3-dien-2-yl-8-methoxy-3-methylnona-3,5,7-trien-1-yne (PubChem CID 143326499) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (3Z,5Z,7E)-6-buta-1,3-dien-2-yl-8-methoxy-3-methylnona-3,5,7-trien-1-yne.
| Compound Name | (3Z,5Z,7E)-6-buta-1,3-dien-2-yl-8-methoxy-3-methylnona-3,5,7-trien-1-yne |
|---|---|
| PubChem CID | 143326499 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (3Z,5Z,7E)-6-buta-1,3-dien-2-yl-8-methoxy-3-methylnona-3,5,7-trien-1-yne |
| SMILES | C#C/C(C)=C\C=C(\C=C(/C)OC)C(=C)C=C |
| InChI | InChI=1S/C15H18O/c1-7-12(3)9-10-15(13(4)8-2)11-14(5)16-6/h1,8-11H,2,4H2,3,5-6H3/b12-9-,14-11+,15-10- |
| InChIKey | GNKASPZDRPLWIS-GXVQVWOKSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|