C13H23NOS — CID 138574738
2-[2-(3-methylhexan-3-yl)-1,3-thiazol-5-yl]propan-2-ol (PubChem CID 138574738) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is 2-[2-(3-methylhexan-3-yl)-1,3-thiazol-5-yl]propan-2-ol.
| Compound Name | 2-[2-(3-methylhexan-3-yl)-1,3-thiazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 138574738 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-[2-(3-methylhexan-3-yl)-1,3-thiazol-5-yl]propan-2-ol |
| SMILES | CCCC(C)(CC)c1ncc(C(C)(C)O)s1 |
| InChI | InChI=1S/C13H23NOS/c1-6-8-13(5,7-2)11-14-9-10(16-11)12(3,4)15/h9,15H,6-8H2,1-5H3 |
| InChIKey | NMHIGCQXKJXAMX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |