C35H24N2O2S — CID 138576034
5-[3-(6-dibenzothiophen-3-yl-2-phenylpyrimidin-4-yl)phenyl]-2-methoxyphenol (PubChem CID 138576034) has the molecular formula C35H24N2O2S and a molecular weight of 536.66 g/mol. Its IUPAC name is 5-[3-(6-dibenzothiophen-3-yl-2-phenylpyrimidin-4-yl)phenyl]-2-methoxyphenol.
| Compound Name | 5-[3-(6-dibenzothiophen-3-yl-2-phenylpyrimidin-4-yl)phenyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 138576034 |
| Molecular Formula | C35H24N2O2S |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 5-[3-(6-dibenzothiophen-3-yl-2-phenylpyrimidin-4-yl)phenyl]-2-methoxyphenol |
| SMILES | COc1ccc(-c2cccc(-c3cc(-c4ccc5c(c4)sc4ccccc45)nc(-c4ccccc4)n3)c2)cc1O |
| InChI | InChI=1S/C35H24N2O2S/c1-39-32-17-15-24(19-31(32)38)23-10-7-11-25(18-23)29-21-30(37-35(36-29)22-8-3-2-4-9-22)26-14-16-28-27-12-5-6-13-33(27)40-34(28)20-26/h2-21,38H,1H3 |
| InChIKey | LIOPPMBYUPTBPU-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |