C26H33N5O — CID 138578681
(Z)-N'-[(3aR)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-4-imino-4-quinolin-6-ylbut-2-enimidamide (PubChem CID 138578681) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is (Z)-N'-[(3aR)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-4-imino-4-quinolin-6-ylbut-2-enimidamide.
| Compound Name | (Z)-N'-[(3aR)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-4-imino-4-quinolin-6-ylbut-2-enimidamide |
|---|---|
| PubChem CID | 138578681 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | (Z)-N'-[(3aR)-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-4-imino-4-quinolin-6-ylbut-2-enimidamide |
| SMILES | [H]/N=C(/C=C\C(N)=N\C1CC2CN(CC3CCOCC3)C[C@@H]2C1)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C26H33N5O/c27-24(19-3-5-25-20(12-19)2-1-9-29-25)4-6-26(28)30-23-13-21-16-31(17-22(21)14-23)15-18-7-10-32-11-8-18/h1-6,9,12,18,21-23,27H,7-8,10-11,13-17H2,(H2,28,30)/b6-4-,27-24-/t21-,22?,23?/m0/s1 |
| InChIKey | ARSIYTKVLZZADG-OMYUNEMISA-N |
| XLogP | 3.65 |
| TPSA | 87.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|