C24H26N6O — CID 143662692
(Z)-N-(1-amino-2-quinolin-6-ylethylidene)-4-(3-formylphenyl)-4-iminobut-2-enimidamide;N-methylmethanamine (PubChem CID 143662692) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is (Z)-N-(1-amino-2-quinolin-6-ylethylidene)-4-(3-formylphenyl)-4-iminobut-2-enimidamide;N-methylmethanamine.
| Compound Name | (Z)-N-(1-amino-2-quinolin-6-ylethylidene)-4-(3-formylphenyl)-4-iminobut-2-enimidamide;N-methylmethanamine |
|---|---|
| PubChem CID | 143662692 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (Z)-N-(1-amino-2-quinolin-6-ylethylidene)-4-(3-formylphenyl)-4-iminobut-2-enimidamide;N-methylmethanamine |
| SMILES | CNC.[H]/N=C(/C=C\C(\N=C(/N)Cc1ccc2ncccc2c1)=N/[H])c1cccc(C=O)c1 |
| InChI | InChI=1S/C22H19N5O.C2H7N/c23-19(17-4-1-3-16(12-17)14-28)7-9-21(24)27-22(25)13-15-6-8-20-18(11-15)5-2-10-26-20;1-3-2/h1-12,14,23H,13H2,(H3,24,25,27);3H,1-2H3/b9-7-,23-19-; |
| InChIKey | SDWFHAVXLVINQF-XFBJBKQOSA-N |
| XLogP | 3.38 |
| TPSA | 128.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|