C28H35FN6O — CID 142958076
(2E,4E)-5-amino-N-(1-amino-3-methylbutylidene)-6-(3-formylbenzenecarboximidoyl)-2-methylhepta-2,4,6-trienimidamide;4-fluoro-N-methylaniline (PubChem CID 142958076) has the molecular formula C28H35FN6O and a molecular weight of 490.63 g/mol. Its IUPAC name is (2E,4E)-5-amino-N-(1-amino-3-methylbutylidene)-6-(3-formylbenzenecarboximidoyl)-2-methylhepta-2,4,6-trienimidamide;4-fluoro-N-methylaniline.
| Compound Name | (2E,4E)-5-amino-N-(1-amino-3-methylbutylidene)-6-(3-formylbenzenecarboximidoyl)-2-methylhepta-2,4,6-trienimidamide;4-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 142958076 |
| Molecular Formula | C28H35FN6O |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (2E,4E)-5-amino-N-(1-amino-3-methylbutylidene)-6-(3-formylbenzenecarboximidoyl)-2-methylhepta-2,4,6-trienimidamide;4-fluoro-N-methylaniline |
| SMILES | CNc1ccc(F)cc1.[H]/N=C(\N=C(\N)CC(C)C)C(/C)=C/C=C(/N)C(=C)/C(=N/[H])c1cccc(C=O)c1 |
| InChI | InChI=1S/C21H27N5O.C7H8FN/c1-13(2)10-19(23)26-21(25)14(3)8-9-18(22)15(4)20(24)17-7-5-6-16(11-17)12-27;1-9-7-4-2-6(8)3-5-7/h5-9,11-13,24H,4,10,22H2,1-3H3,(H3,23,25,26);2-5,9H,1H3/b14-8+,18-9+,24-20-; |
| InChIKey | YBQXVYVPLGYWLS-GFSONWPWSA-N |
| XLogP | 5.46 |
| TPSA | 141.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|