C22H29N5O — CID 138578974
(3aS,6aR)-2-(oxan-4-ylmethyl)-N-(6-pyridin-3-ylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 138578974) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is (3aS,6aR)-2-(oxan-4-ylmethyl)-N-(6-pyridin-3-ylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aS,6aR)-2-(oxan-4-ylmethyl)-N-(6-pyridin-3-ylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 138578974 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (3aS,6aR)-2-(oxan-4-ylmethyl)-N-(6-pyridin-3-ylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | c1cncc(-c2ccc(NC3C[C@@H]4CN(CC5CCOCC5)C[C@@H]4C3)nn2)c1 |
| InChI | InChI=1S/C22H29N5O/c1-2-17(12-23-7-1)21-3-4-22(26-25-21)24-20-10-18-14-27(15-19(18)11-20)13-16-5-8-28-9-6-16/h1-4,7,12,16,18-20H,5-6,8-11,13-15H2,(H,24,26)/t18-,19+,20? |
| InChIKey | NOQMIVUGDYGFDO-YOFSQIOKSA-N |
| XLogP | 3.09 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |