C18H23N3O5 — CID 138580160
methyl (2S)-5-[6-[(E)-hydroxyiminomethyl]-5-methyl-2-pyridinyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoate (PubChem CID 138580160) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is methyl (2S)-5-[6-[(E)-hydroxyiminomethyl]-5-methyl-2-pyridinyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoate.
| Compound Name | methyl (2S)-5-[6-[(E)-hydroxyiminomethyl]-5-methyl-2-pyridinyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoate |
|---|---|
| PubChem CID | 138580160 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | methyl (2S)-5-[6-[(E)-hydroxyiminomethyl]-5-methyl-2-pyridinyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoate |
| SMILES | COC(=O)[C@H](CC#Cc1ccc(C)c(/C=N/O)n1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23N3O5/c1-12-9-10-13(20-15(12)11-19-24)7-6-8-14(16(22)25-5)21-17(23)26-18(2,3)4/h9-11,14,24H,8H2,1-5H3,(H,21,23)/b19-11+/t14-/m0/s1 |
| InChIKey | NHQDSJORBFYHFI-YRIIZNAFSA-N |
| XLogP | 2.01 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|