C21H18F2N2O6 — CID 138597009
1-[4-[(2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl)amino]phenyl]azetidine-3-carboxylic acid (PubChem CID 138597009) has the molecular formula C21H18F2N2O6 and a molecular weight of 432.38 g/mol. Its IUPAC name is 1-[4-[(2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl)amino]phenyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[4-[(2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl)amino]phenyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 138597009 |
| Molecular Formula | C21H18F2N2O6 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1-[4-[(2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl)amino]phenyl]azetidine-3-carboxylic acid |
| SMILES | CC1(C(=O)Nc2ccc(N3CC(C(=O)O)C3)cc2)COc2cc3c(cc21)OC(F)(F)O3 |
| InChI | InChI=1S/C21H18F2N2O6/c1-20(10-29-15-7-17-16(6-14(15)20)30-21(22,23)31-17)19(28)24-12-2-4-13(5-3-12)25-8-11(9-25)18(26)27/h2-7,11H,8-10H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | CTUVGOOYYNJCKN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|