C21H32N4O7 — CID 138599196
N-[1-(3,8-dioxooctan-2-ylamino)-1-oxopropan-2-yl]-2-[[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)acetyl]amino]propanamide (PubChem CID 138599196) has the molecular formula C21H32N4O7 and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[1-(3,8-dioxooctan-2-ylamino)-1-oxopropan-2-yl]-2-[[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)acetyl]amino]propanamide.
| Compound Name | N-[1-(3,8-dioxooctan-2-ylamino)-1-oxopropan-2-yl]-2-[[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 138599196 |
| Molecular Formula | C21H32N4O7 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-[1-(3,8-dioxooctan-2-ylamino)-1-oxopropan-2-yl]-2-[[2-(3-methyl-2,5-dioxopyrrolidin-1-yl)acetyl]amino]propanamide |
| SMILES | CC1CC(=O)N(CC(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)CCCCC=O)C1=O |
| InChI | InChI=1S/C21H32N4O7/c1-12-10-18(29)25(21(12)32)11-17(28)22-14(3)19(30)24-15(4)20(31)23-13(2)16(27)8-6-5-7-9-26/h9,12-15H,5-8,10-11H2,1-4H3,(H,22,28)(H,23,31)(H,24,30) |
| InChIKey | GDBRKUXJGYJWAG-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|