C24H26F3N3O3 — CID 138600014
3-[3-tert-butyl-5-[5-(trifluoromethyl)benzotriazol-2-yl]phenoxy]propyl 2-methylprop-2-enoate (PubChem CID 138600014) has the molecular formula C24H26F3N3O3 and a molecular weight of 461.48 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-[5-(trifluoromethyl)benzotriazol-2-yl]phenoxy]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[3-tert-butyl-5-[5-(trifluoromethyl)benzotriazol-2-yl]phenoxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138600014 |
| Molecular Formula | C24H26F3N3O3 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 3-[3-tert-butyl-5-[5-(trifluoromethyl)benzotriazol-2-yl]phenoxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOc1cc(-n2nc3ccc(C(F)(F)F)cc3n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H26F3N3O3/c1-15(2)22(31)33-10-6-9-32-19-12-17(23(3,4)5)11-18(14-19)30-28-20-8-7-16(24(25,26)27)13-21(20)29-30/h7-8,11-14H,1,6,9-10H2,2-5H3 |
| InChIKey | OVCJEDYFACORHE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|