C21H19F3N2O3 — CID 70031317
3-[4-hydroxy-3-[5-(trifluoromethyl)indazol-2-yl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 70031317) has the molecular formula C21H19F3N2O3 and a molecular weight of 404.39 g/mol. Its IUPAC name is 3-[4-hydroxy-3-[5-(trifluoromethyl)indazol-2-yl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-hydroxy-3-[5-(trifluoromethyl)indazol-2-yl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70031317 |
| Molecular Formula | C21H19F3N2O3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 3-[4-hydroxy-3-[5-(trifluoromethyl)indazol-2-yl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1ccc(O)c(-n2cc3cc(C(F)(F)F)ccc3n2)c1 |
| InChI | InChI=1S/C21H19F3N2O3/c1-13(2)20(28)29-9-3-4-14-5-8-19(27)18(10-14)26-12-15-11-16(21(22,23)24)6-7-17(15)25-26/h5-8,10-12,27H,1,3-4,9H2,2H3 |
| InChIKey | XBKGIHDUOWSUGS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|