C26H34F3N3O3Si — CID 162549073
3-trimethylsilylpropyl 3-[3-tert-butyl-4-hydroxy-5-[5-(trifluoromethyl)benzotriazol-2-yl]phenyl]propanoate (PubChem CID 162549073) has the molecular formula C26H34F3N3O3Si and a molecular weight of 521.66 g/mol. Its IUPAC name is 3-trimethylsilylpropyl 3-[3-tert-butyl-4-hydroxy-5-[5-(trifluoromethyl)benzotriazol-2-yl]phenyl]propanoate.
| Compound Name | 3-trimethylsilylpropyl 3-[3-tert-butyl-4-hydroxy-5-[5-(trifluoromethyl)benzotriazol-2-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 162549073 |
| Molecular Formula | C26H34F3N3O3Si |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 3-trimethylsilylpropyl 3-[3-tert-butyl-4-hydroxy-5-[5-(trifluoromethyl)benzotriazol-2-yl]phenyl]propanoate |
| SMILES | CC(C)(C)c1cc(CCC(=O)OCCC[Si](C)(C)C)cc(-n2nc3ccc(C(F)(F)F)cc3n2)c1O |
| InChI | InChI=1S/C26H34F3N3O3Si/c1-25(2,3)19-14-17(8-11-23(33)35-12-7-13-36(4,5)6)15-22(24(19)34)32-30-20-10-9-18(26(27,28)29)16-21(20)31-32/h9-10,14-16,34H,7-8,11-13H2,1-6H3 |
| InChIKey | ZYJSHLPALQBSQM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|