C16H20S — CID 138605345
2,3,4,5-tetrakis[(Z)-prop-1-enyl]thiophene (PubChem CID 138605345) has the molecular formula C16H20S and a molecular weight of 244.40 g/mol. Its IUPAC name is 2,3,4,5-tetrakis[(Z)-prop-1-enyl]thiophene.
| Compound Name | 2,3,4,5-tetrakis[(Z)-prop-1-enyl]thiophene |
|---|---|
| PubChem CID | 138605345 |
| Molecular Formula | C16H20S |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2,3,4,5-tetrakis[(Z)-prop-1-enyl]thiophene |
| SMILES | C/C=C\c1sc(/C=C\C)c(/C=C\C)c1/C=C\C |
| InChI | InChI=1S/C16H20S/c1-5-9-13-14(10-6-2)16(12-8-4)17-15(13)11-7-3/h5-12H,1-4H3/b9-5-,10-6-,11-7-,12-8- |
| InChIKey | RVDQXIYQOANERR-XIMJPLDWSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |