About 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one
3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one (PubChem CID 134285804) has the molecular formula C14H16OS
and a molecular weight of 232.35 g/mol. Its IUPAC name is 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one.
Molecular Properties
| Compound Name | 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one |
| PubChem CID | 134285804 |
| Molecular Formula | C14H16OS |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one |
| SMILES | C=Cc1c(/C=C\C)sc(/C=C\C)c(C)c1=O |
| InChI | InChI=1S/C14H16OS/c1-5-8-12-10(4)14(15)11(7-3)13(16-12)9-6-2/h5-9H,3H2,1-2,4H3/b8-5-,9-6- |
| InChIKey | LRXIFKYIAWULMU-VVRUXRSYSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one?
The IUPAC name of 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one (CID 134285804) is 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one.
What is the SMILES notation for 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one?
The canonical SMILES for 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one is C=Cc1c(/C=C\C)sc(/C=C\C)c(C)c1=O.
What is the InChIKey of 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one?
The InChIKey is LRXIFKYIAWULMU-VVRUXRSYSA-N. The full InChI is InChI=1S/C14H16OS/c1-5-8-12-10(4)14(15)11(7-3)13(16-12)9-6-2/h5-9H,3H2,1-2,4H3/b8-5-,9-6-.
What are the key properties of 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one?
3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one has a molecular weight of 232.35 g/mol, XLogP of 4.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-5-methyl-2,6-bis[(Z)-prop-1-enyl]thiopyran-4-one is sourced from PubChem (CID 134285804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).