C18H26O — CID 138606628
(2R,4aS,4bS,8aR,9S,10aS)-2,9-dimethyl-4,5-dimethylidene-2,4a,4b,6,7,8,8a,9,10,10a-decahydro-1H-phenanthren-3-one (PubChem CID 138606628) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is (2R,4aS,4bS,8aR,9S,10aS)-2,9-dimethyl-4,5-dimethylidene-2,4a,4b,6,7,8,8a,9,10,10a-decahydro-1H-phenanthren-3-one.
| Compound Name | (2R,4aS,4bS,8aR,9S,10aS)-2,9-dimethyl-4,5-dimethylidene-2,4a,4b,6,7,8,8a,9,10,10a-decahydro-1H-phenanthren-3-one |
|---|---|
| PubChem CID | 138606628 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (2R,4aS,4bS,8aR,9S,10aS)-2,9-dimethyl-4,5-dimethylidene-2,4a,4b,6,7,8,8a,9,10,10a-decahydro-1H-phenanthren-3-one |
| SMILES | C=C1C(=O)[C@H](C)C[C@@H]2C[C@H](C)[C@H]3CCCC(=C)[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C18H26O/c1-10-6-5-7-15-11(2)8-14-9-12(3)18(19)13(4)17(14)16(10)15/h11-12,14-17H,1,4-9H2,2-3H3/t11-,12+,14-,15+,16-,17-/m0/s1 |
| InChIKey | NIDWAKNZIAONOO-XPNFKZKTSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|