C16H24O2 — CID 164932593
(4aS,8aR)-2,9-dimethyl-1,2,3,4a,4b,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-4,5-dione (PubChem CID 164932593) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (4aS,8aR)-2,9-dimethyl-1,2,3,4a,4b,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-4,5-dione.
| Compound Name | (4aS,8aR)-2,9-dimethyl-1,2,3,4a,4b,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-4,5-dione |
|---|---|
| PubChem CID | 164932593 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (4aS,8aR)-2,9-dimethyl-1,2,3,4a,4b,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-4,5-dione |
| SMILES | CC1CC(=O)[C@H]2C(C1)CC(C)[C@H]1CCCC(=O)C12 |
| InChI | InChI=1S/C16H24O2/c1-9-6-11-8-10(2)12-4-3-5-13(17)16(12)15(11)14(18)7-9/h9-12,15-16H,3-8H2,1-2H3/t9?,10?,11?,12-,15-,16?/m1/s1 |
| InChIKey | OEUDWWWCTAHUEU-FKEHYZMWSA-N |
| XLogP | 3.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |