C19H31N3O4 — CID 138608582
tert-butyl 4-[2-(dimethoxymethyl)-6-(methylamino)-3-pyridinyl]piperidine-1-carboxylate (PubChem CID 138608582) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is tert-butyl 4-[2-(dimethoxymethyl)-6-(methylamino)-3-pyridinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(dimethoxymethyl)-6-(methylamino)-3-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 138608582 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | tert-butyl 4-[2-(dimethoxymethyl)-6-(methylamino)-3-pyridinyl]piperidine-1-carboxylate |
| SMILES | CNc1ccc(C2CCN(C(=O)OC(C)(C)C)CC2)c(C(OC)OC)n1 |
| InChI | InChI=1S/C19H31N3O4/c1-19(2,3)26-18(23)22-11-9-13(10-12-22)14-7-8-15(20-4)21-16(14)17(24-5)25-6/h7-8,13,17H,9-12H2,1-6H3,(H,20,21) |
| InChIKey | KQSJAEVTLXNEIT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|