C23H19F3N4O2 — CID 138609165
N-(6-amino-2,3-difluorophenyl)-4-[1-[(5-fluoro-2-pyridinyl)carbamoyl]cyclobutyl]benzamide (PubChem CID 138609165) has the molecular formula C23H19F3N4O2 and a molecular weight of 440.43 g/mol. Its IUPAC name is N-(6-amino-2,3-difluorophenyl)-4-[1-[(5-fluoro-2-pyridinyl)carbamoyl]cyclobutyl]benzamide.
| Compound Name | N-(6-amino-2,3-difluorophenyl)-4-[1-[(5-fluoro-2-pyridinyl)carbamoyl]cyclobutyl]benzamide |
|---|---|
| PubChem CID | 138609165 |
| Molecular Formula | C23H19F3N4O2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-(6-amino-2,3-difluorophenyl)-4-[1-[(5-fluoro-2-pyridinyl)carbamoyl]cyclobutyl]benzamide |
| SMILES | Nc1ccc(F)c(F)c1NC(=O)c1ccc(C2(C(=O)Nc3ccc(F)cn3)CCC2)cc1 |
| InChI | InChI=1S/C23H19F3N4O2/c24-15-6-9-18(28-12-15)29-22(32)23(10-1-11-23)14-4-2-13(3-5-14)21(31)30-20-17(27)8-7-16(25)19(20)26/h2-9,12H,1,10-11,27H2,(H,30,31)(H,28,29,32) |
| InChIKey | RCRPMNOUVDRYOF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|