About CID 89307313
CID 89307313 (PubChem CID 89307313) has the molecular formula C26H24BN5O
and a molecular weight of 433.32 g/mol.
Molecular Properties
| Compound Name | CID 89307313 |
| PubChem CID | 89307313 |
| Molecular Formula | C26H24BN5O |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)C2(c3ccc(-c4cnc(-n5c(C)ccc5C)nc4)cc3)CCC2)nc1 |
| InChI | InChI=1S/C26H24BN5O/c1-17-4-5-18(2)32(17)25-29-14-20(15-30-25)19-6-8-21(9-7-19)26(12-3-13-26)24(33)31-23-11-10-22(27)16-28-23/h4-11,14-16H,3,12-13H2,1-2H3,(H,28,31,33) |
| InChIKey | SAWTYEYNWBBOGZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89307313 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89307313?
The IUPAC name of CID 89307313 (CID 89307313) is not available.
What is the SMILES notation for CID 89307313?
The canonical SMILES for CID 89307313 is [B]c1ccc(NC(=O)C2(c3ccc(-c4cnc(-n5c(C)ccc5C)nc4)cc3)CCC2)nc1.
What is the InChIKey of CID 89307313?
The InChIKey is SAWTYEYNWBBOGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24BN5O/c1-17-4-5-18(2)32(17)25-29-14-20(15-30-25)19-6-8-21(9-7-19)26(12-3-13-26)24(33)31-23-11-10-22(27)16-28-23/h4-11,14-16H,3,12-13H2,1-2H3,(H,28,31,33).
What are the key properties of CID 89307313?
CID 89307313 has a molecular weight of 433.32 g/mol, XLogP of 3.80, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89307313 is sourced from PubChem (CID 89307313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).