C26H24BN5O — CID 89307313
CID 89307313 (PubChem CID 89307313) has the molecular formula C26H24BN5O and a molecular weight of 433.32 g/mol.
| Compound Name | CID 89307313 |
|---|---|
| PubChem CID | 89307313 |
| Molecular Formula | C26H24BN5O |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)C2(c3ccc(-c4cnc(-n5c(C)ccc5C)nc4)cc3)CCC2)nc1 |
| InChI | InChI=1S/C26H24BN5O/c1-17-4-5-18(2)32(17)25-29-14-20(15-30-25)19-6-8-21(9-7-19)26(12-3-13-26)24(33)31-23-11-10-22(27)16-28-23/h4-11,14-16H,3,12-13H2,1-2H3,(H,28,31,33) |
| InChIKey | SAWTYEYNWBBOGZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|