C9H16N7O14P3 — CID 138611382
[[(2R,3S,5R)-3-aminoperoxy-5-[4-(2-diazohydrazinyl)-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 138611382) has the molecular formula C9H16N7O14P3 and a molecular weight of 539.18 g/mol. Its IUPAC name is [[(2R,3S,5R)-3-aminoperoxy-5-[4-(2-diazohydrazinyl)-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-3-aminoperoxy-5-[4-(2-diazohydrazinyl)-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 138611382 |
| Molecular Formula | C9H16N7O14P3 |
| Molecular Weight | 539.18 g/mol |
| Exact Mass | 539.00 |
| IUPAC Name | [[(2R,3S,5R)-3-aminoperoxy-5-[4-(2-diazohydrazinyl)-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=NNc1ccn([C@H]2C[C@H](OON)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C9H16N7O14P3/c10-14-15-13-7-1-2-16(9(17)12-7)8-3-5(27-28-11)6(26-8)4-25-32(21,22)30-33(23,24)29-31(18,19)20/h1-2,5-6,8H,3-4,11H2,(H,21,22)(H,23,24)(H,12,13,17)(H2,18,19,20)/t5-,6+,8+/m0/s1 |
| InChIKey | COHWEBHUOKEYCG-SHYZEUOFSA-N |
| XLogP | -0.30 |
| TPSA | 309.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.18 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|