C30H38F2N4OS — CID 138611564
9-amino-N-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]nonanamide (PubChem CID 138611564) has the molecular formula C30H38F2N4OS and a molecular weight of 540.72 g/mol. Its IUPAC name is 9-amino-N-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]nonanamide.
| Compound Name | 9-amino-N-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]nonanamide |
|---|---|
| PubChem CID | 138611564 |
| Molecular Formula | C30H38F2N4OS |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 9-amino-N-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]nonanamide |
| SMILES | NCCCCCCCCC(=O)Nc1ccc2c(-c3cccc(C(N)=S)c3)cn(C3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C30H38F2N4OS/c31-30(32)15-13-24(14-16-30)36-20-26(21-8-7-9-22(18-21)29(34)38)25-12-11-23(19-27(25)36)35-28(37)10-5-3-1-2-4-6-17-33/h7-9,11-12,18-20,24H,1-6,10,13-17,33H2,(H2,34,38)(H,35,37) |
| InChIKey | RIJXGNACIQTPQJ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|