C45H50F2N6O6S — CID 138630190
N'-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]ethyl]nonanediamide (PubChem CID 138630190) has the molecular formula C45H50F2N6O6S and a molecular weight of 840.99 g/mol. Its IUPAC name is N'-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]ethyl]nonanediamide.
| Compound Name | N'-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]ethyl]nonanediamide |
|---|---|
| PubChem CID | 138630190 |
| Molecular Formula | C45H50F2N6O6S |
| Molecular Weight | 840.99 g/mol |
| Exact Mass | 840.35 |
| IUPAC Name | N'-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]-N-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]ethyl]nonanediamide |
| SMILES | NC(=S)c1cccc(-c2cn(C3CCC(F)(F)CC3)c3cc(NC(=O)CCCCCCCC(=O)NCCOc4cccc5c4CN(C4CCC(=O)NC4=O)C5=O)ccc23)c1 |
| InChI | InChI=1S/C45H50F2N6O6S/c46-45(47)20-18-31(19-21-45)52-26-34(28-8-6-9-29(24-28)42(48)60)32-15-14-30(25-37(32)52)50-40(55)13-5-3-1-2-4-12-39(54)49-22-23-59-38-11-7-10-33-35(38)27-53(44(33)58)36-16-17-41(56)51-43(36)57/h6-11,14-15,24-26,31,36H,1-5,12-13,16-23,27H2,(H2,48,60)(H,49,54)(H,50,55)(H,51,56,57) |
| InChIKey | QTBZHTUEFQGUKG-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 164.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.99 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|