C42H42F2N6O7S — CID 138630189
N-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]-6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]hexanamide (PubChem CID 138630189) has the molecular formula C42H42F2N6O7S and a molecular weight of 812.90 g/mol. Its IUPAC name is N-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]-6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]hexanamide.
| Compound Name | N-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]-6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]hexanamide |
|---|---|
| PubChem CID | 138630189 |
| Molecular Formula | C42H42F2N6O7S |
| Molecular Weight | 812.90 g/mol |
| Exact Mass | 812.28 |
| IUPAC Name | N-[3-(3-carbamothioylphenyl)-1-(4,4-difluorocyclohexyl)indol-6-yl]-6-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]hexanamide |
| SMILES | NC(=S)c1cccc(-c2cn(C3CCC(F)(F)CC3)c3cc(NC(=O)CCCCCNC(=O)COc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)ccc23)c1 |
| InChI | InChI=1S/C42H42F2N6O7S/c43-42(44)17-15-27(16-18-42)49-22-30(24-6-4-7-25(20-24)38(45)58)28-12-11-26(21-32(28)49)47-34(51)10-2-1-3-19-46-36(53)23-57-33-9-5-8-29-37(33)41(56)50(40(29)55)31-13-14-35(52)48-39(31)54/h4-9,11-12,20-22,27,31H,1-3,10,13-19,23H2,(H2,45,58)(H,46,53)(H,47,51)(H,48,52,54) |
| InChIKey | ZZCSHAIXQCLTMU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 181.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.90 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|