C16H18ClN5O2 — CID 138612413
N-[[5-(3-chloro-4-methoxyphenyl)-1,3-oxazol-4-yl]methyl]-3-(1,2,4-triazol-1-yl)propan-1-amine (PubChem CID 138612413) has the molecular formula C16H18ClN5O2 and a molecular weight of 347.81 g/mol. Its IUPAC name is N-[[5-(3-chloro-4-methoxyphenyl)-1,3-oxazol-4-yl]methyl]-3-(1,2,4-triazol-1-yl)propan-1-amine.
| Compound Name | N-[[5-(3-chloro-4-methoxyphenyl)-1,3-oxazol-4-yl]methyl]-3-(1,2,4-triazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 138612413 |
| Molecular Formula | C16H18ClN5O2 |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[[5-(3-chloro-4-methoxyphenyl)-1,3-oxazol-4-yl]methyl]-3-(1,2,4-triazol-1-yl)propan-1-amine |
| SMILES | COc1ccc(-c2ocnc2CNCCCn2cncn2)cc1Cl |
| InChI | InChI=1S/C16H18ClN5O2/c1-23-15-4-3-12(7-13(15)17)16-14(20-11-24-16)8-18-5-2-6-22-10-19-9-21-22/h3-4,7,9-11,18H,2,5-6,8H2,1H3 |
| InChIKey | FDRPYMREDOWJNG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|