C10H18S — CID 138612681
bicyclo[4.2.2]decane-7-thiol (PubChem CID 138612681) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is bicyclo[4.2.2]decane-7-thiol.
| Compound Name | bicyclo[4.2.2]decane-7-thiol |
|---|---|
| PubChem CID | 138612681 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | bicyclo[4.2.2]decane-7-thiol |
| SMILES | SC1CC2CCCCC1CC2 |
| InChI | InChI=1S/C10H18S/c11-10-7-8-3-1-2-4-9(10)6-5-8/h8-11H,1-7H2 |
| InChIKey | ISMHTPOEGSVKRJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|