C8H11N — CID 138614470
5-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine (PubChem CID 138614470) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 5-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine.
| Compound Name | 5-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 138614470 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 5-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine |
| SMILES | CC1=CC=C(N)C2CC12 |
| InChI | InChI=1S/C8H11N/c1-5-2-3-8(9)7-4-6(5)7/h2-3,6-7H,4,9H2,1H3 |
| InChIKey | NIMBPOIOPLWGEL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |