C10H15N3O3 — CID 138618165
3-(3,4-diaminophenoxy)propyl carbamate (PubChem CID 138618165) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-(3,4-diaminophenoxy)propyl carbamate.
| Compound Name | 3-(3,4-diaminophenoxy)propyl carbamate |
|---|---|
| PubChem CID | 138618165 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 3-(3,4-diaminophenoxy)propyl carbamate |
| SMILES | NC(=O)OCCCOc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C10H15N3O3/c11-8-3-2-7(6-9(8)12)15-4-1-5-16-10(13)14/h2-3,6H,1,4-5,11-12H2,(H2,13,14) |
| InChIKey | MAEBIRUJZNTDBL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|