C27H36O — CID 138623383
4,6b,8a,11,14a-pentamethyl-6a,7,8,9,10,11,12,12a,13,14-decahydropicen-2-one (PubChem CID 138623383) has the molecular formula C27H36O and a molecular weight of 376.58 g/mol. Its IUPAC name is 4,6b,8a,11,14a-pentamethyl-6a,7,8,9,10,11,12,12a,13,14-decahydropicen-2-one.
| Compound Name | 4,6b,8a,11,14a-pentamethyl-6a,7,8,9,10,11,12,12a,13,14-decahydropicen-2-one |
|---|---|
| PubChem CID | 138623383 |
| Molecular Formula | C27H36O |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 4,6b,8a,11,14a-pentamethyl-6a,7,8,9,10,11,12,12a,13,14-decahydropicen-2-one |
| SMILES | CC1=CC(=O)C=C2C1=CC=C1C2(C)CCC2C3CC(C)CCC3(C)CCC12C |
| InChI | InChI=1S/C27H36O/c1-17-8-10-25(3)12-13-27(5)21(23(25)14-17)9-11-26(4)22-16-19(28)15-18(2)20(22)6-7-24(26)27/h6-7,15-17,21,23H,8-14H2,1-5H3 |
| InChIKey | IXPWHTZLEFNCPP-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |