C28H36O3 — CID 173013825
9-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,11,12,12a,13,14-octahydropicene-2,10-dione (PubChem CID 173013825) has the molecular formula C28H36O3 and a molecular weight of 420.59 g/mol. Its IUPAC name is 9-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,11,12,12a,13,14-octahydropicene-2,10-dione.
| Compound Name | 9-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,11,12,12a,13,14-octahydropicene-2,10-dione |
|---|---|
| PubChem CID | 173013825 |
| Molecular Formula | C28H36O3 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 9-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,11,12,12a,13,14-octahydropicene-2,10-dione |
| SMILES | CC1=CC(=O)C=C2C1=CC=C1C2(C)CCC2(C)C3CC(C)C(=O)C(O)C3(C)CCC12C |
| InChI | InChI=1S/C28H36O3/c1-16-13-18(29)15-20-19(16)7-8-21-25(20,3)9-11-28(6)22-14-17(2)23(30)24(31)26(22,4)10-12-27(21,28)5/h7-8,13,15,17,22,24,31H,9-12,14H2,1-6H3 |
| InChIKey | DBGUJDMJVXKVJX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |