C28H38O5 — CID 163034322
methyl (2Z)-2-[(4bS,6aR,7S,9R,10aS,10bS,12aR)-2-acetyl-7-hydroxy-4b,6a,9,10b,12a-pentamethyl-8-oxo-5,6,7,9,10,10a,11,12-octahydrochrysen-1-ylidene]acetate (PubChem CID 163034322) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is methyl (2Z)-2-[(4bS,6aR,7S,9R,10aS,10bS,12aR)-2-acetyl-7-hydroxy-4b,6a,9,10b,12a-pentamethyl-8-oxo-5,6,7,9,10,10a,11,12-octahydrochrysen-1-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[(4bS,6aR,7S,9R,10aS,10bS,12aR)-2-acetyl-7-hydroxy-4b,6a,9,10b,12a-pentamethyl-8-oxo-5,6,7,9,10,10a,11,12-octahydrochrysen-1-ylidene]acetate |
|---|---|
| PubChem CID | 163034322 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | methyl (2Z)-2-[(4bS,6aR,7S,9R,10aS,10bS,12aR)-2-acetyl-7-hydroxy-4b,6a,9,10b,12a-pentamethyl-8-oxo-5,6,7,9,10,10a,11,12-octahydrochrysen-1-ylidene]acetate |
| SMILES | COC(=O)/C=C1\C(C(C)=O)=CC=C2[C@@]1(C)CC[C@@]1(C)[C@@H]3C[C@@H](C)C(=O)[C@@H](O)[C@]3(C)CC[C@]21C |
| InChI | InChI=1S/C28H38O5/c1-16-14-21-26(4,24(32)23(16)31)11-13-27(5)20-9-8-18(17(2)29)19(15-22(30)33-7)25(20,3)10-12-28(21,27)6/h8-9,15-16,21,24,32H,10-14H2,1-7H3/b19-15+/t16-,21-,24-,25+,26-,27-,28+/m1/s1 |
| InChIKey | AXTDWQFUQQFNPB-HPSZYYLOSA-N |
| XLogP | 4.74 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|