C28H40O4 — CID 145435939
4,6b,8a,11,14a-pentamethyl-6a,7,8,9,10,11,12,12a,13,14-decahydro-5H-picene-2,3-diol;formic acid (PubChem CID 145435939) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is 4,6b,8a,11,14a-pentamethyl-6a,7,8,9,10,11,12,12a,13,14-decahydro-5H-picene-2,3-diol;formic acid.
| Compound Name | 4,6b,8a,11,14a-pentamethyl-6a,7,8,9,10,11,12,12a,13,14-decahydro-5H-picene-2,3-diol;formic acid |
|---|---|
| PubChem CID | 145435939 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 4,6b,8a,11,14a-pentamethyl-6a,7,8,9,10,11,12,12a,13,14-decahydro-5H-picene-2,3-diol;formic acid |
| SMILES | Cc1c(O)c(O)cc2c1CC=C1C2(C)CCC2C3CC(C)CCC3(C)CCC12C.O=CO |
| InChI | InChI=1S/C27H38O2.CH2O2/c1-16-8-10-25(3)12-13-27(5)19(21(25)14-16)9-11-26(4)20-15-22(28)24(29)17(2)18(20)6-7-23(26)27;2-1-3/h7,15-16,19,21,28-29H,6,8-14H2,1-5H3;1H,(H,2,3) |
| InChIKey | APQHGAALXYPUNK-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|