C29H40O2 — CID 145301000
(11R)-11-ethyl-3-hydroxy-4,6b,8a,11,14a-pentamethyl-7,8,9,10,12,12a,13,14-octahydro-6aH-picen-2-one (PubChem CID 145301000) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is (11R)-11-ethyl-3-hydroxy-4,6b,8a,11,14a-pentamethyl-7,8,9,10,12,12a,13,14-octahydro-6aH-picen-2-one.
| Compound Name | (11R)-11-ethyl-3-hydroxy-4,6b,8a,11,14a-pentamethyl-7,8,9,10,12,12a,13,14-octahydro-6aH-picen-2-one |
|---|---|
| PubChem CID | 145301000 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | (11R)-11-ethyl-3-hydroxy-4,6b,8a,11,14a-pentamethyl-7,8,9,10,12,12a,13,14-octahydro-6aH-picen-2-one |
| SMILES | CC[C@]1(C)CCC2(C)CCC3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)C4(C)CCC3C2C1 |
| InChI | InChI=1S/C29H40O2/c1-7-26(3)12-13-27(4)14-15-29(6)20(22(27)17-26)10-11-28(5)21-16-23(30)25(31)18(2)19(21)8-9-24(28)29/h8-9,16,20,22,31H,7,10-15,17H2,1-6H3/t20?,22?,26-,27?,28?,29?/m1/s1 |
| InChIKey | JBPAPVGLAZBLJJ-BOGORIHLSA-N |
| XLogP | 7.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |