C22H24Cl3FN2O4 — CID 138632427
2-(4-chloro-3-fluorophenoxy)-N-[4-[2-(3,4-dichlorophenoxy)ethylamino]-2-hydroxyhex-5-enyl]acetamide (PubChem CID 138632427) has the molecular formula C22H24Cl3FN2O4 and a molecular weight of 505.80 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenoxy)-N-[4-[2-(3,4-dichlorophenoxy)ethylamino]-2-hydroxyhex-5-enyl]acetamide.
| Compound Name | 2-(4-chloro-3-fluorophenoxy)-N-[4-[2-(3,4-dichlorophenoxy)ethylamino]-2-hydroxyhex-5-enyl]acetamide |
|---|---|
| PubChem CID | 138632427 |
| Molecular Formula | C22H24Cl3FN2O4 |
| Molecular Weight | 505.80 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 2-(4-chloro-3-fluorophenoxy)-N-[4-[2-(3,4-dichlorophenoxy)ethylamino]-2-hydroxyhex-5-enyl]acetamide |
| SMILES | C=CC(CC(O)CNC(=O)COc1ccc(Cl)c(F)c1)NCCOc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H24Cl3FN2O4/c1-2-14(27-7-8-31-16-3-5-18(23)20(25)10-16)9-15(29)12-28-22(30)13-32-17-4-6-19(24)21(26)11-17/h2-6,10-11,14-15,27,29H,1,7-9,12-13H2,(H,28,30) |
| InChIKey | GKXDHBZWKRCLMJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.80 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|