C19H21ClFN3O5 — CID 166896144
5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-hydroxy-N-(1,3-oxazol-4-ylmethyl)hept-6-enamide (PubChem CID 166896144) has the molecular formula C19H21ClFN3O5 and a molecular weight of 425.84 g/mol. Its IUPAC name is 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-hydroxy-N-(1,3-oxazol-4-ylmethyl)hept-6-enamide.
| Compound Name | 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-hydroxy-N-(1,3-oxazol-4-ylmethyl)hept-6-enamide |
|---|---|
| PubChem CID | 166896144 |
| Molecular Formula | C19H21ClFN3O5 |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-hydroxy-N-(1,3-oxazol-4-ylmethyl)hept-6-enamide |
| SMILES | C=CC(CC(O)CC(=O)NCc1cocn1)NC(=O)COc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C19H21ClFN3O5/c1-2-12(5-14(25)6-18(26)22-8-13-9-28-11-23-13)24-19(27)10-29-15-3-4-16(20)17(21)7-15/h2-4,7,9,11-12,14,25H,1,5-6,8,10H2,(H,22,26)(H,24,27) |
| InChIKey | PDOLUBVBZQESOY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|