C21H20ClF4N3O4 — CID 170084279
5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[6-(trifluoromethoxy)-3-pyridinyl]hept-6-enamide (PubChem CID 170084279) has the molecular formula C21H20ClF4N3O4 and a molecular weight of 489.85 g/mol. Its IUPAC name is 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[6-(trifluoromethoxy)-3-pyridinyl]hept-6-enamide.
| Compound Name | 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[6-(trifluoromethoxy)-3-pyridinyl]hept-6-enamide |
|---|---|
| PubChem CID | 170084279 |
| Molecular Formula | C21H20ClF4N3O4 |
| Molecular Weight | 489.85 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[6-(trifluoromethoxy)-3-pyridinyl]hept-6-enamide |
| SMILES | C=CC(CCCC(=O)Nc1ccc(OC(F)(F)F)nc1)NC(=O)COc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C21H20ClF4N3O4/c1-2-13(28-19(31)12-32-15-7-8-16(22)17(23)10-15)4-3-5-18(30)29-14-6-9-20(27-11-14)33-21(24,25)26/h2,6-11,13H,1,3-5,12H2,(H,28,31)(H,29,30) |
| InChIKey | ORPAYBOYHBLXSE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.85 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|