C20H21Cl2N3O3 — CID 155264954
N-[6-[[2-(3,4-dichlorophenoxy)acetyl]amino]hex-1-en-3-yl]pyridine-2-carboxamide (PubChem CID 155264954) has the molecular formula C20H21Cl2N3O3 and a molecular weight of 422.31 g/mol. Its IUPAC name is N-[6-[[2-(3,4-dichlorophenoxy)acetyl]amino]hex-1-en-3-yl]pyridine-2-carboxamide.
| Compound Name | N-[6-[[2-(3,4-dichlorophenoxy)acetyl]amino]hex-1-en-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155264954 |
| Molecular Formula | C20H21Cl2N3O3 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[6-[[2-(3,4-dichlorophenoxy)acetyl]amino]hex-1-en-3-yl]pyridine-2-carboxamide |
| SMILES | C=CC(CCCNC(=O)COc1ccc(Cl)c(Cl)c1)NC(=O)c1ccccn1 |
| InChI | InChI=1S/C20H21Cl2N3O3/c1-2-14(25-20(27)18-7-3-4-10-23-18)6-5-11-24-19(26)13-28-15-8-9-16(21)17(22)12-15/h2-4,7-10,12,14H,1,5-6,11,13H2,(H,24,26)(H,25,27) |
| InChIKey | RWDUMONKKNTLQI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|