C14H17N3O2 — CID 138634703
3,3-dimethyl-1-[(E)-3-(5-methyl-1H-pyrazol-4-yl)prop-2-enoyl]-2H-pyridin-6-one (PubChem CID 138634703) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(E)-3-(5-methyl-1H-pyrazol-4-yl)prop-2-enoyl]-2H-pyridin-6-one.
| Compound Name | 3,3-dimethyl-1-[(E)-3-(5-methyl-1H-pyrazol-4-yl)prop-2-enoyl]-2H-pyridin-6-one |
|---|---|
| PubChem CID | 138634703 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3,3-dimethyl-1-[(E)-3-(5-methyl-1H-pyrazol-4-yl)prop-2-enoyl]-2H-pyridin-6-one |
| SMILES | Cc1[nH]ncc1/C=C/C(=O)N1CC(C)(C)C=CC1=O |
| InChI | InChI=1S/C14H17N3O2/c1-10-11(8-15-16-10)4-5-12(18)17-9-14(2,3)7-6-13(17)19/h4-8H,9H2,1-3H3,(H,15,16)/b5-4+ |
| InChIKey | OADXMCQUBQDWNI-SNAWJCMRSA-N |
| XLogP | 1.68 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|